About 5-chloro-1-(3-methyl-1,1-dioxothiolan-3-yl)-3-propylpyrazole-4-sulfonyl chloride
5-chloro-1-(3-methyl-1,1-dioxothiolan-3-yl)-3-propylpyrazole-4-sulfonyl chloride (PubChem CID 82915847) has the molecular formula C11H16Cl2N2O4S2
and a molecular weight of 375.30 g/mol. Its IUPAC name is 5-chloro-1-(3-methyl-1,1-dioxothiolan-3-yl)-3-propylpyrazole-4-sulfonyl chloride.
Molecular Properties
| Compound Name | 5-chloro-1-(3-methyl-1,1-dioxothiolan-3-yl)-3-propylpyrazole-4-sulfonyl chloride |
| PubChem CID | 82915847 |
| Molecular Formula | C11H16Cl2N2O4S2 |
| Molecular Weight | 375.30 g/mol |
| Exact Mass | 373.99 |
| IUPAC Name | 5-chloro-1-(3-methyl-1,1-dioxothiolan-3-yl)-3-propylpyrazole-4-sulfonyl chloride |
| SMILES | CCCc1nn(C2(C)CCS(=O)(=O)C2)c(Cl)c1S(=O)(=O)Cl |
| InChI | InChI=1S/C11H16Cl2N2O4S2/c1-3-4-8-9(21(13,18)19)10(12)15(14-8)11(2)5-6-20(16,17)7-11/h3-7H2,1-2H3 |
| InChIKey | YWZZTNZKJWJGEH-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 86.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.30 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-chloro-1-(3-methyl-1,1-dioxothiolan-3-yl)-3-propylpyrazole-4-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-1-(3-methyl-1,1-dioxothiolan-3-yl)-3-propylpyrazole-4-sulfonyl chloride?
The IUPAC name of 5-chloro-1-(3-methyl-1,1-dioxothiolan-3-yl)-3-propylpyrazole-4-sulfonyl chloride (CID 82915847) is 5-chloro-1-(3-methyl-1,1-dioxothiolan-3-yl)-3-propylpyrazole-4-sulfonyl chloride.
What is the SMILES notation for 5-chloro-1-(3-methyl-1,1-dioxothiolan-3-yl)-3-propylpyrazole-4-sulfonyl chloride?
The canonical SMILES for 5-chloro-1-(3-methyl-1,1-dioxothiolan-3-yl)-3-propylpyrazole-4-sulfonyl chloride is CCCc1nn(C2(C)CCS(=O)(=O)C2)c(Cl)c1S(=O)(=O)Cl.
What is the InChIKey of 5-chloro-1-(3-methyl-1,1-dioxothiolan-3-yl)-3-propylpyrazole-4-sulfonyl chloride?
The InChIKey is YWZZTNZKJWJGEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16Cl2N2O4S2/c1-3-4-8-9(21(13,18)19)10(12)15(14-8)11(2)5-6-20(16,17)7-11/h3-7H2,1-2H3.
What are the key properties of 5-chloro-1-(3-methyl-1,1-dioxothiolan-3-yl)-3-propylpyrazole-4-sulfonyl chloride?
5-chloro-1-(3-methyl-1,1-dioxothiolan-3-yl)-3-propylpyrazole-4-sulfonyl chloride has a molecular weight of 375.30 g/mol, XLogP of 1.95, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-1-(3-methyl-1,1-dioxothiolan-3-yl)-3-propylpyrazole-4-sulfonyl chloride is sourced from PubChem (CID 82915847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).