About (E)-2-cyano-3-(2,5-dimethyl-1-pyridin-3-ylpyrrol-3-yl)-N-(furan-2-ylmethyl)prop-2-enamide
(E)-2-cyano-3-(2,5-dimethyl-1-pyridin-3-ylpyrrol-3-yl)-N-(furan-2-ylmethyl)prop-2-enamide (PubChem CID 829165) has the molecular formula C20H18N4O2
and a molecular weight of 346.39 g/mol. Its IUPAC name is (E)-2-cyano-3-(2,5-dimethyl-1-pyridin-3-ylpyrrol-3-yl)-N-(furan-2-ylmethyl)prop-2-enamide.
Molecular Properties
| Compound Name | (E)-2-cyano-3-(2,5-dimethyl-1-pyridin-3-ylpyrrol-3-yl)-N-(furan-2-ylmethyl)prop-2-enamide |
| PubChem CID | 829165 |
| Molecular Formula | C20H18N4O2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | (E)-2-cyano-3-(2,5-dimethyl-1-pyridin-3-ylpyrrol-3-yl)-N-(furan-2-ylmethyl)prop-2-enamide |
| SMILES | Cc1cc(/C=C(\C#N)C(=O)NCc2ccco2)c(C)n1-c1cccnc1 |
| InChI | InChI=1S/C20H18N4O2/c1-14-9-16(15(2)24(14)18-5-3-7-22-12-18)10-17(11-21)20(25)23-13-19-6-4-8-26-19/h3-10,12H,13H2,1-2H3,(H,23,25)/b17-10+ |
| InChIKey | ROMNKFLHMPMTJP-LICLKQGHSA-N |
| XLogP | 3.31 |
| TPSA | 83.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-cyano-3-(2,5-dimethyl-1-pyridin-3-ylpyrrol-3-yl)-N-(furan-2-ylmethyl)prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-cyano-3-(2,5-dimethyl-1-pyridin-3-ylpyrrol-3-yl)-N-(furan-2-ylmethyl)prop-2-enamide?
The IUPAC name of (E)-2-cyano-3-(2,5-dimethyl-1-pyridin-3-ylpyrrol-3-yl)-N-(furan-2-ylmethyl)prop-2-enamide (CID 829165) is (E)-2-cyano-3-(2,5-dimethyl-1-pyridin-3-ylpyrrol-3-yl)-N-(furan-2-ylmethyl)prop-2-enamide.
What is the SMILES notation for (E)-2-cyano-3-(2,5-dimethyl-1-pyridin-3-ylpyrrol-3-yl)-N-(furan-2-ylmethyl)prop-2-enamide?
The canonical SMILES for (E)-2-cyano-3-(2,5-dimethyl-1-pyridin-3-ylpyrrol-3-yl)-N-(furan-2-ylmethyl)prop-2-enamide is Cc1cc(/C=C(\C#N)C(=O)NCc2ccco2)c(C)n1-c1cccnc1.
What is the InChIKey of (E)-2-cyano-3-(2,5-dimethyl-1-pyridin-3-ylpyrrol-3-yl)-N-(furan-2-ylmethyl)prop-2-enamide?
The InChIKey is ROMNKFLHMPMTJP-LICLKQGHSA-N. The full InChI is InChI=1S/C20H18N4O2/c1-14-9-16(15(2)24(14)18-5-3-7-22-12-18)10-17(11-21)20(25)23-13-19-6-4-8-26-19/h3-10,12H,13H2,1-2H3,(H,23,25)/b17-10+.
What are the key properties of (E)-2-cyano-3-(2,5-dimethyl-1-pyridin-3-ylpyrrol-3-yl)-N-(furan-2-ylmethyl)prop-2-enamide?
(E)-2-cyano-3-(2,5-dimethyl-1-pyridin-3-ylpyrrol-3-yl)-N-(furan-2-ylmethyl)prop-2-enamide has a molecular weight of 346.39 g/mol, XLogP of 3.31, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-cyano-3-(2,5-dimethyl-1-pyridin-3-ylpyrrol-3-yl)-N-(furan-2-ylmethyl)prop-2-enamide is sourced from PubChem (CID 829165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).