C13H20N2S — CID 82916858
N,4-dimethyl-N-(thiomorpholin-3-ylmethyl)aniline (PubChem CID 82916858) has the molecular formula C13H20N2S and a molecular weight of 236.38 g/mol. Its IUPAC name is N,4-dimethyl-N-(thiomorpholin-3-ylmethyl)aniline.
| Compound Name | N,4-dimethyl-N-(thiomorpholin-3-ylmethyl)aniline |
|---|---|
| PubChem CID | 82916858 |
| Molecular Formula | C13H20N2S |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | N,4-dimethyl-N-(thiomorpholin-3-ylmethyl)aniline |
| SMILES | Cc1ccc(N(C)CC2CSCCN2)cc1 |
| InChI | InChI=1S/C13H20N2S/c1-11-3-5-13(6-4-11)15(2)9-12-10-16-8-7-14-12/h3-6,12,14H,7-10H2,1-2H3 |
| InChIKey | CEDYBLVDEXTNCH-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|