C12H16ClNO5S — CID 82917868
4-[2-(2-methoxyethylamino)-2-oxoethoxy]-3-methylbenzenesulfonyl chloride (PubChem CID 82917868) has the molecular formula C12H16ClNO5S and a molecular weight of 321.78 g/mol. Its IUPAC name is 4-[2-(2-methoxyethylamino)-2-oxoethoxy]-3-methylbenzenesulfonyl chloride.
| Compound Name | 4-[2-(2-methoxyethylamino)-2-oxoethoxy]-3-methylbenzenesulfonyl chloride |
|---|---|
| PubChem CID | 82917868 |
| Molecular Formula | C12H16ClNO5S |
| Molecular Weight | 321.78 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | 4-[2-(2-methoxyethylamino)-2-oxoethoxy]-3-methylbenzenesulfonyl chloride |
| SMILES | COCCNC(=O)COc1ccc(S(=O)(=O)Cl)cc1C |
| InChI | InChI=1S/C12H16ClNO5S/c1-9-7-10(20(13,16)17)3-4-11(9)19-8-12(15)14-5-6-18-2/h3-4,7H,5-6,8H2,1-2H3,(H,14,15) |
| InChIKey | KGBCHAMNRYLGFH-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.78 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|