C9H8F2N4 — CID 82918182
1-[(3,4-difluorophenyl)methyl]-1,2,4-triazol-3-amine (PubChem CID 82918182) has the molecular formula C9H8F2N4 and a molecular weight of 210.19 g/mol. Its IUPAC name is 1-[(3,4-difluorophenyl)methyl]-1,2,4-triazol-3-amine.
| Compound Name | 1-[(3,4-difluorophenyl)methyl]-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 82918182 |
| Molecular Formula | C9H8F2N4 |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | 1-[(3,4-difluorophenyl)methyl]-1,2,4-triazol-3-amine |
| SMILES | Nc1ncn(Cc2ccc(F)c(F)c2)n1 |
| InChI | InChI=1S/C9H8F2N4/c10-7-2-1-6(3-8(7)11)4-15-5-13-9(12)14-15/h1-3,5H,4H2,(H2,12,14) |
| InChIKey | LGVOUSUBPGVWQT-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |