About 5-chloro-1-(2,6-dimethylpyrimidin-4-yl)-3-methylpyrazole-4-sulfonyl chloride
5-chloro-1-(2,6-dimethylpyrimidin-4-yl)-3-methylpyrazole-4-sulfonyl chloride (PubChem CID 82919032) has the molecular formula C10H10Cl2N4O2S
and a molecular weight of 321.19 g/mol. Its IUPAC name is 5-chloro-1-(2,6-dimethylpyrimidin-4-yl)-3-methylpyrazole-4-sulfonyl chloride.
Molecular Properties
| Compound Name | 5-chloro-1-(2,6-dimethylpyrimidin-4-yl)-3-methylpyrazole-4-sulfonyl chloride |
| PubChem CID | 82919032 |
| Molecular Formula | C10H10Cl2N4O2S |
| Molecular Weight | 321.19 g/mol |
| Exact Mass | 319.99 |
| IUPAC Name | 5-chloro-1-(2,6-dimethylpyrimidin-4-yl)-3-methylpyrazole-4-sulfonyl chloride |
| SMILES | Cc1cc(-n2nc(C)c(S(=O)(=O)Cl)c2Cl)nc(C)n1 |
| InChI | InChI=1S/C10H10Cl2N4O2S/c1-5-4-8(14-7(3)13-5)16-10(11)9(6(2)15-16)19(12,17)18/h4H,1-3H3 |
| InChIKey | NWOMPAKGACFJKS-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 77.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.19 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-chloro-1-(2,6-dimethylpyrimidin-4-yl)-3-methylpyrazole-4-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-1-(2,6-dimethylpyrimidin-4-yl)-3-methylpyrazole-4-sulfonyl chloride?
The IUPAC name of 5-chloro-1-(2,6-dimethylpyrimidin-4-yl)-3-methylpyrazole-4-sulfonyl chloride (CID 82919032) is 5-chloro-1-(2,6-dimethylpyrimidin-4-yl)-3-methylpyrazole-4-sulfonyl chloride.
What is the SMILES notation for 5-chloro-1-(2,6-dimethylpyrimidin-4-yl)-3-methylpyrazole-4-sulfonyl chloride?
The canonical SMILES for 5-chloro-1-(2,6-dimethylpyrimidin-4-yl)-3-methylpyrazole-4-sulfonyl chloride is Cc1cc(-n2nc(C)c(S(=O)(=O)Cl)c2Cl)nc(C)n1.
What is the InChIKey of 5-chloro-1-(2,6-dimethylpyrimidin-4-yl)-3-methylpyrazole-4-sulfonyl chloride?
The InChIKey is NWOMPAKGACFJKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10Cl2N4O2S/c1-5-4-8(14-7(3)13-5)16-10(11)9(6(2)15-16)19(12,17)18/h4H,1-3H3.
What are the key properties of 5-chloro-1-(2,6-dimethylpyrimidin-4-yl)-3-methylpyrazole-4-sulfonyl chloride?
5-chloro-1-(2,6-dimethylpyrimidin-4-yl)-3-methylpyrazole-4-sulfonyl chloride has a molecular weight of 321.19 g/mol, XLogP of 2.17, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-1-(2,6-dimethylpyrimidin-4-yl)-3-methylpyrazole-4-sulfonyl chloride is sourced from PubChem (CID 82919032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).