About 3-ethyl-1-(1,4-oxathian-2-yl)pentan-1-one
3-ethyl-1-(1,4-oxathian-2-yl)pentan-1-one (PubChem CID 82920108) has the molecular formula C11H20O2S
and a molecular weight of 216.35 g/mol. Its IUPAC name is 3-ethyl-1-(1,4-oxathian-2-yl)pentan-1-one.
Molecular Properties
| Compound Name | 3-ethyl-1-(1,4-oxathian-2-yl)pentan-1-one |
| PubChem CID | 82920108 |
| Molecular Formula | C11H20O2S |
| Molecular Weight | 216.35 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | 3-ethyl-1-(1,4-oxathian-2-yl)pentan-1-one |
| SMILES | CCC(CC)CC(=O)C1CSCCO1 |
| InChI | InChI=1S/C11H20O2S/c1-3-9(4-2)7-10(12)11-8-14-6-5-13-11/h9,11H,3-8H2,1-2H3 |
| InChIKey | XVTRRUNVHXYXBU-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.35 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-ethyl-1-(1,4-oxathian-2-yl)pentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-1-(1,4-oxathian-2-yl)pentan-1-one?
The IUPAC name of 3-ethyl-1-(1,4-oxathian-2-yl)pentan-1-one (CID 82920108) is 3-ethyl-1-(1,4-oxathian-2-yl)pentan-1-one.
What is the SMILES notation for 3-ethyl-1-(1,4-oxathian-2-yl)pentan-1-one?
The canonical SMILES for 3-ethyl-1-(1,4-oxathian-2-yl)pentan-1-one is CCC(CC)CC(=O)C1CSCCO1.
What is the InChIKey of 3-ethyl-1-(1,4-oxathian-2-yl)pentan-1-one?
The InChIKey is XVTRRUNVHXYXBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O2S/c1-3-9(4-2)7-10(12)11-8-14-6-5-13-11/h9,11H,3-8H2,1-2H3.
What are the key properties of 3-ethyl-1-(1,4-oxathian-2-yl)pentan-1-one?
3-ethyl-1-(1,4-oxathian-2-yl)pentan-1-one has a molecular weight of 216.35 g/mol, XLogP of 2.51, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-1-(1,4-oxathian-2-yl)pentan-1-one is sourced from PubChem (CID 82920108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).