C15H11ClF2OS — CID 82920301
1-(3-chlorophenyl)sulfanyl-3-(3,4-difluorophenyl)propan-2-one (PubChem CID 82920301) has the molecular formula C15H11ClF2OS and a molecular weight of 312.77 g/mol. Its IUPAC name is 1-(3-chlorophenyl)sulfanyl-3-(3,4-difluorophenyl)propan-2-one.
| Compound Name | 1-(3-chlorophenyl)sulfanyl-3-(3,4-difluorophenyl)propan-2-one |
|---|---|
| PubChem CID | 82920301 |
| Molecular Formula | C15H11ClF2OS |
| Molecular Weight | 312.77 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | 1-(3-chlorophenyl)sulfanyl-3-(3,4-difluorophenyl)propan-2-one |
| SMILES | O=C(CSc1cccc(Cl)c1)Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H11ClF2OS/c16-11-2-1-3-13(8-11)20-9-12(19)6-10-4-5-14(17)15(18)7-10/h1-5,7-8H,6,9H2 |
| InChIKey | DJRPOKALGYJRQZ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.77 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |