C13H18N2O4S — CID 82921293
N-(cyclopropylmethyl)-2-(4-methyl-2-sulfamoylphenoxy)acetamide (PubChem CID 82921293) has the molecular formula C13H18N2O4S and a molecular weight of 298.36 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-2-(4-methyl-2-sulfamoylphenoxy)acetamide.
| Compound Name | N-(cyclopropylmethyl)-2-(4-methyl-2-sulfamoylphenoxy)acetamide |
|---|---|
| PubChem CID | 82921293 |
| Molecular Formula | C13H18N2O4S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | N-(cyclopropylmethyl)-2-(4-methyl-2-sulfamoylphenoxy)acetamide |
| SMILES | Cc1ccc(OCC(=O)NCC2CC2)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C13H18N2O4S/c1-9-2-5-11(12(6-9)20(14,17)18)19-8-13(16)15-7-10-3-4-10/h2,5-6,10H,3-4,7-8H2,1H3,(H,15,16)(H2,14,17,18) |
| InChIKey | CTAXDFWWXJFNTN-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |