About 1-tert-butylsulfanyl-N,4-diethylhexan-2-amine
1-tert-butylsulfanyl-N,4-diethylhexan-2-amine (PubChem CID 82922711) has the molecular formula C14H31NS
and a molecular weight of 245.48 g/mol. Its IUPAC name is 1-tert-butylsulfanyl-N,4-diethylhexan-2-amine.
Molecular Properties
| Compound Name | 1-tert-butylsulfanyl-N,4-diethylhexan-2-amine |
| PubChem CID | 82922711 |
| Molecular Formula | C14H31NS |
| Molecular Weight | 245.48 g/mol |
| Exact Mass | 245.22 |
| IUPAC Name | 1-tert-butylsulfanyl-N,4-diethylhexan-2-amine |
| SMILES | CCNC(CSC(C)(C)C)CC(CC)CC |
| InChI | InChI=1S/C14H31NS/c1-7-12(8-2)10-13(15-9-3)11-16-14(4,5)6/h12-13,15H,7-11H2,1-6H3 |
| InChIKey | OSENXEITSDTXLT-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.48 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-tert-butylsulfanyl-N,4-diethylhexan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butylsulfanyl-N,4-diethylhexan-2-amine?
The IUPAC name of 1-tert-butylsulfanyl-N,4-diethylhexan-2-amine (CID 82922711) is 1-tert-butylsulfanyl-N,4-diethylhexan-2-amine.
What is the SMILES notation for 1-tert-butylsulfanyl-N,4-diethylhexan-2-amine?
The canonical SMILES for 1-tert-butylsulfanyl-N,4-diethylhexan-2-amine is CCNC(CSC(C)(C)C)CC(CC)CC.
What is the InChIKey of 1-tert-butylsulfanyl-N,4-diethylhexan-2-amine?
The InChIKey is OSENXEITSDTXLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H31NS/c1-7-12(8-2)10-13(15-9-3)11-16-14(4,5)6/h12-13,15H,7-11H2,1-6H3.
What are the key properties of 1-tert-butylsulfanyl-N,4-diethylhexan-2-amine?
1-tert-butylsulfanyl-N,4-diethylhexan-2-amine has a molecular weight of 245.48 g/mol, XLogP of 4.32, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butylsulfanyl-N,4-diethylhexan-2-amine is sourced from PubChem (CID 82922711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).