C14H19F4N — CID 82923278
3-ethyl-1-[5-fluoro-2-(trifluoromethyl)phenyl]pentan-1-amine (PubChem CID 82923278) has the molecular formula C14H19F4N and a molecular weight of 277.31 g/mol. Its IUPAC name is 3-ethyl-1-[5-fluoro-2-(trifluoromethyl)phenyl]pentan-1-amine.
| Compound Name | 3-ethyl-1-[5-fluoro-2-(trifluoromethyl)phenyl]pentan-1-amine |
|---|---|
| PubChem CID | 82923278 |
| Molecular Formula | C14H19F4N |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 3-ethyl-1-[5-fluoro-2-(trifluoromethyl)phenyl]pentan-1-amine |
| SMILES | CCC(CC)CC(N)c1cc(F)ccc1C(F)(F)F |
| InChI | InChI=1S/C14H19F4N/c1-3-9(4-2)7-13(19)11-8-10(15)5-6-12(11)14(16,17)18/h5-6,8-9,13H,3-4,7,19H2,1-2H3 |
| InChIKey | KZQZUTNXBDGQFU-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |