About N,4-diethyl-1,1-dimethoxyhexan-2-amine
N,4-diethyl-1,1-dimethoxyhexan-2-amine (PubChem CID 82923358) has the molecular formula C12H27NO2
and a molecular weight of 217.35 g/mol. Its IUPAC name is N,4-diethyl-1,1-dimethoxyhexan-2-amine.
Molecular Properties
| Compound Name | N,4-diethyl-1,1-dimethoxyhexan-2-amine |
| PubChem CID | 82923358 |
| Molecular Formula | C12H27NO2 |
| Molecular Weight | 217.35 g/mol |
| Exact Mass | 217.20 |
| IUPAC Name | N,4-diethyl-1,1-dimethoxyhexan-2-amine |
| SMILES | CCNC(CC(CC)CC)C(OC)OC |
| InChI | InChI=1S/C12H27NO2/c1-6-10(7-2)9-11(13-8-3)12(14-4)15-5/h10-13H,6-9H2,1-5H3 |
| InChIKey | JJWJGLZMHPHECF-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.35 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N,4-diethyl-1,1-dimethoxyhexan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,4-diethyl-1,1-dimethoxyhexan-2-amine?
The IUPAC name of N,4-diethyl-1,1-dimethoxyhexan-2-amine (CID 82923358) is N,4-diethyl-1,1-dimethoxyhexan-2-amine.
What is the SMILES notation for N,4-diethyl-1,1-dimethoxyhexan-2-amine?
The canonical SMILES for N,4-diethyl-1,1-dimethoxyhexan-2-amine is CCNC(CC(CC)CC)C(OC)OC.
What is the InChIKey of N,4-diethyl-1,1-dimethoxyhexan-2-amine?
The InChIKey is JJWJGLZMHPHECF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27NO2/c1-6-10(7-2)9-11(13-8-3)12(14-4)15-5/h10-13H,6-9H2,1-5H3.
What are the key properties of N,4-diethyl-1,1-dimethoxyhexan-2-amine?
N,4-diethyl-1,1-dimethoxyhexan-2-amine has a molecular weight of 217.35 g/mol, XLogP of 2.41, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,4-diethyl-1,1-dimethoxyhexan-2-amine is sourced from PubChem (CID 82923358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).