About 1-cyclohexyl-3-cyclopropyl-3-methyl-4,5-dihydro-2H-1,4-benzodiazepine
1-cyclohexyl-3-cyclopropyl-3-methyl-4,5-dihydro-2H-1,4-benzodiazepine (PubChem CID 82923775) has the molecular formula C19H28N2
and a molecular weight of 284.45 g/mol. Its IUPAC name is 1-cyclohexyl-3-cyclopropyl-3-methyl-4,5-dihydro-2H-1,4-benzodiazepine.
Molecular Properties
| Compound Name | 1-cyclohexyl-3-cyclopropyl-3-methyl-4,5-dihydro-2H-1,4-benzodiazepine |
| PubChem CID | 82923775 |
| Molecular Formula | C19H28N2 |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.23 |
| IUPAC Name | 1-cyclohexyl-3-cyclopropyl-3-methyl-4,5-dihydro-2H-1,4-benzodiazepine |
| SMILES | CC1(C2CC2)CN(C2CCCCC2)c2ccccc2CN1 |
| InChI | InChI=1S/C19H28N2/c1-19(16-11-12-16)14-21(17-8-3-2-4-9-17)18-10-6-5-7-15(18)13-20-19/h5-7,10,16-17,20H,2-4,8-9,11-14H2,1H3 |
| InChIKey | UOQBTJXHUKNCFO-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-cyclohexyl-3-cyclopropyl-3-methyl-4,5-dihydro-2H-1,4-benzodiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-3-cyclopropyl-3-methyl-4,5-dihydro-2H-1,4-benzodiazepine?
The IUPAC name of 1-cyclohexyl-3-cyclopropyl-3-methyl-4,5-dihydro-2H-1,4-benzodiazepine (CID 82923775) is 1-cyclohexyl-3-cyclopropyl-3-methyl-4,5-dihydro-2H-1,4-benzodiazepine.
What is the SMILES notation for 1-cyclohexyl-3-cyclopropyl-3-methyl-4,5-dihydro-2H-1,4-benzodiazepine?
The canonical SMILES for 1-cyclohexyl-3-cyclopropyl-3-methyl-4,5-dihydro-2H-1,4-benzodiazepine is CC1(C2CC2)CN(C2CCCCC2)c2ccccc2CN1.
What is the InChIKey of 1-cyclohexyl-3-cyclopropyl-3-methyl-4,5-dihydro-2H-1,4-benzodiazepine?
The InChIKey is UOQBTJXHUKNCFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28N2/c1-19(16-11-12-16)14-21(17-8-3-2-4-9-17)18-10-6-5-7-15(18)13-20-19/h5-7,10,16-17,20H,2-4,8-9,11-14H2,1H3.
What are the key properties of 1-cyclohexyl-3-cyclopropyl-3-methyl-4,5-dihydro-2H-1,4-benzodiazepine?
1-cyclohexyl-3-cyclopropyl-3-methyl-4,5-dihydro-2H-1,4-benzodiazepine has a molecular weight of 284.45 g/mol, XLogP of 4.10, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-3-cyclopropyl-3-methyl-4,5-dihydro-2H-1,4-benzodiazepine is sourced from PubChem (CID 82923775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).