About 6-(2-ethylbutyl)-8,8-dimethyl-6,9-diazaspiro[4.5]decane
6-(2-ethylbutyl)-8,8-dimethyl-6,9-diazaspiro[4.5]decane (PubChem CID 82923848) has the molecular formula C16H32N2
and a molecular weight of 252.45 g/mol. Its IUPAC name is 6-(2-ethylbutyl)-8,8-dimethyl-6,9-diazaspiro[4.5]decane.
Molecular Properties
| Compound Name | 6-(2-ethylbutyl)-8,8-dimethyl-6,9-diazaspiro[4.5]decane |
| PubChem CID | 82923848 |
| Molecular Formula | C16H32N2 |
| Molecular Weight | 252.45 g/mol |
| Exact Mass | 252.26 |
| IUPAC Name | 6-(2-ethylbutyl)-8,8-dimethyl-6,9-diazaspiro[4.5]decane |
| SMILES | CCC(CC)CN1CC(C)(C)NCC12CCCC2 |
| InChI | InChI=1S/C16H32N2/c1-5-14(6-2)11-18-13-15(3,4)17-12-16(18)9-7-8-10-16/h14,17H,5-13H2,1-4H3 |
| InChIKey | LCSKPADICYXROC-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.45 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-(2-ethylbutyl)-8,8-dimethyl-6,9-diazaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-ethylbutyl)-8,8-dimethyl-6,9-diazaspiro[4.5]decane?
The IUPAC name of 6-(2-ethylbutyl)-8,8-dimethyl-6,9-diazaspiro[4.5]decane (CID 82923848) is 6-(2-ethylbutyl)-8,8-dimethyl-6,9-diazaspiro[4.5]decane.
What is the SMILES notation for 6-(2-ethylbutyl)-8,8-dimethyl-6,9-diazaspiro[4.5]decane?
The canonical SMILES for 6-(2-ethylbutyl)-8,8-dimethyl-6,9-diazaspiro[4.5]decane is CCC(CC)CN1CC(C)(C)NCC12CCCC2.
What is the InChIKey of 6-(2-ethylbutyl)-8,8-dimethyl-6,9-diazaspiro[4.5]decane?
The InChIKey is LCSKPADICYXROC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32N2/c1-5-14(6-2)11-18-13-15(3,4)17-12-16(18)9-7-8-10-16/h14,17H,5-13H2,1-4H3.
What are the key properties of 6-(2-ethylbutyl)-8,8-dimethyl-6,9-diazaspiro[4.5]decane?
6-(2-ethylbutyl)-8,8-dimethyl-6,9-diazaspiro[4.5]decane has a molecular weight of 252.45 g/mol, XLogP of 3.42, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-ethylbutyl)-8,8-dimethyl-6,9-diazaspiro[4.5]decane is sourced from PubChem (CID 82923848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).