About 11-(2-ethylbutyl)-7,11-diazaspiro[5.6]dodecane
11-(2-ethylbutyl)-7,11-diazaspiro[5.6]dodecane (PubChem CID 82924129) has the molecular formula C16H32N2
and a molecular weight of 252.45 g/mol. Its IUPAC name is 11-(2-ethylbutyl)-7,11-diazaspiro[5.6]dodecane.
Molecular Properties
| Compound Name | 11-(2-ethylbutyl)-7,11-diazaspiro[5.6]dodecane |
| PubChem CID | 82924129 |
| Molecular Formula | C16H32N2 |
| Molecular Weight | 252.45 g/mol |
| Exact Mass | 252.26 |
| IUPAC Name | 11-(2-ethylbutyl)-7,11-diazaspiro[5.6]dodecane |
| SMILES | CCC(CC)CN1CCCNC2(CCCCC2)C1 |
| InChI | InChI=1S/C16H32N2/c1-3-15(4-2)13-18-12-8-11-17-16(14-18)9-6-5-7-10-16/h15,17H,3-14H2,1-2H3 |
| InChIKey | OLZWROLLFRTFGZ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.45 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 11-(2-ethylbutyl)-7,11-diazaspiro[5.6]dodecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-(2-ethylbutyl)-7,11-diazaspiro[5.6]dodecane?
The IUPAC name of 11-(2-ethylbutyl)-7,11-diazaspiro[5.6]dodecane (CID 82924129) is 11-(2-ethylbutyl)-7,11-diazaspiro[5.6]dodecane.
What is the SMILES notation for 11-(2-ethylbutyl)-7,11-diazaspiro[5.6]dodecane?
The canonical SMILES for 11-(2-ethylbutyl)-7,11-diazaspiro[5.6]dodecane is CCC(CC)CN1CCCNC2(CCCCC2)C1.
What is the InChIKey of 11-(2-ethylbutyl)-7,11-diazaspiro[5.6]dodecane?
The InChIKey is OLZWROLLFRTFGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32N2/c1-3-15(4-2)13-18-12-8-11-17-16(14-18)9-6-5-7-10-16/h15,17H,3-14H2,1-2H3.
What are the key properties of 11-(2-ethylbutyl)-7,11-diazaspiro[5.6]dodecane?
11-(2-ethylbutyl)-7,11-diazaspiro[5.6]dodecane has a molecular weight of 252.45 g/mol, XLogP of 3.42, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 11-(2-ethylbutyl)-7,11-diazaspiro[5.6]dodecane is sourced from PubChem (CID 82924129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).