About 1-(2-ethylbutyl)-2,3-dihydro-1H-isoindole
1-(2-ethylbutyl)-2,3-dihydro-1H-isoindole (PubChem CID 82924962) has the molecular formula C14H21N
and a molecular weight of 203.33 g/mol. Its IUPAC name is 1-(2-ethylbutyl)-2,3-dihydro-1H-isoindole.
Molecular Properties
| Compound Name | 1-(2-ethylbutyl)-2,3-dihydro-1H-isoindole |
| PubChem CID | 82924962 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | 1-(2-ethylbutyl)-2,3-dihydro-1H-isoindole |
| SMILES | CCC(CC)CC1NCc2ccccc21 |
| InChI | InChI=1S/C14H21N/c1-3-11(4-2)9-14-13-8-6-5-7-12(13)10-15-14/h5-8,11,14-15H,3-4,9-10H2,1-2H3 |
| InChIKey | NRPDYTIDKJVBER-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(2-ethylbutyl)-2,3-dihydro-1H-isoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-ethylbutyl)-2,3-dihydro-1H-isoindole?
The IUPAC name of 1-(2-ethylbutyl)-2,3-dihydro-1H-isoindole (CID 82924962) is 1-(2-ethylbutyl)-2,3-dihydro-1H-isoindole.
What is the SMILES notation for 1-(2-ethylbutyl)-2,3-dihydro-1H-isoindole?
The canonical SMILES for 1-(2-ethylbutyl)-2,3-dihydro-1H-isoindole is CCC(CC)CC1NCc2ccccc21.
What is the InChIKey of 1-(2-ethylbutyl)-2,3-dihydro-1H-isoindole?
The InChIKey is NRPDYTIDKJVBER-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N/c1-3-11(4-2)9-14-13-8-6-5-7-12(13)10-15-14/h5-8,11,14-15H,3-4,9-10H2,1-2H3.
What are the key properties of 1-(2-ethylbutyl)-2,3-dihydro-1H-isoindole?
1-(2-ethylbutyl)-2,3-dihydro-1H-isoindole has a molecular weight of 203.33 g/mol, XLogP of 3.66, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-ethylbutyl)-2,3-dihydro-1H-isoindole is sourced from PubChem (CID 82924962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).