About 5,5-diethyl-1-(2-ethylbutyl)-2,2-dimethylpiperazine
5,5-diethyl-1-(2-ethylbutyl)-2,2-dimethylpiperazine (PubChem CID 82925143) has the molecular formula C16H34N2
and a molecular weight of 254.46 g/mol. Its IUPAC name is 5,5-diethyl-1-(2-ethylbutyl)-2,2-dimethylpiperazine.
Molecular Properties
| Compound Name | 5,5-diethyl-1-(2-ethylbutyl)-2,2-dimethylpiperazine |
| PubChem CID | 82925143 |
| Molecular Formula | C16H34N2 |
| Molecular Weight | 254.46 g/mol |
| Exact Mass | 254.27 |
| IUPAC Name | 5,5-diethyl-1-(2-ethylbutyl)-2,2-dimethylpiperazine |
| SMILES | CCC(CC)CN1CC(CC)(CC)NCC1(C)C |
| InChI | InChI=1S/C16H34N2/c1-7-14(8-2)11-18-13-16(9-3,10-4)17-12-15(18,5)6/h14,17H,7-13H2,1-6H3 |
| InChIKey | MLBNDYWDGZVIKD-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.46 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,5-diethyl-1-(2-ethylbutyl)-2,2-dimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-diethyl-1-(2-ethylbutyl)-2,2-dimethylpiperazine?
The IUPAC name of 5,5-diethyl-1-(2-ethylbutyl)-2,2-dimethylpiperazine (CID 82925143) is 5,5-diethyl-1-(2-ethylbutyl)-2,2-dimethylpiperazine.
What is the SMILES notation for 5,5-diethyl-1-(2-ethylbutyl)-2,2-dimethylpiperazine?
The canonical SMILES for 5,5-diethyl-1-(2-ethylbutyl)-2,2-dimethylpiperazine is CCC(CC)CN1CC(CC)(CC)NCC1(C)C.
What is the InChIKey of 5,5-diethyl-1-(2-ethylbutyl)-2,2-dimethylpiperazine?
The InChIKey is MLBNDYWDGZVIKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H34N2/c1-7-14(8-2)11-18-13-16(9-3,10-4)17-12-15(18,5)6/h14,17H,7-13H2,1-6H3.
What are the key properties of 5,5-diethyl-1-(2-ethylbutyl)-2,2-dimethylpiperazine?
5,5-diethyl-1-(2-ethylbutyl)-2,2-dimethylpiperazine has a molecular weight of 254.46 g/mol, XLogP of 3.67, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-diethyl-1-(2-ethylbutyl)-2,2-dimethylpiperazine is sourced from PubChem (CID 82925143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).