C13H24N2O2 — CID 82929019
3-ethyl-1-(5-methoxy-1,3-dimethylpyrazol-4-yl)pentan-1-ol (PubChem CID 82929019) has the molecular formula C13H24N2O2 and a molecular weight of 240.35 g/mol. Its IUPAC name is 3-ethyl-1-(5-methoxy-1,3-dimethylpyrazol-4-yl)pentan-1-ol.
| Compound Name | 3-ethyl-1-(5-methoxy-1,3-dimethylpyrazol-4-yl)pentan-1-ol |
|---|---|
| PubChem CID | 82929019 |
| Molecular Formula | C13H24N2O2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.18 |
| IUPAC Name | 3-ethyl-1-(5-methoxy-1,3-dimethylpyrazol-4-yl)pentan-1-ol |
| SMILES | CCC(CC)CC(O)c1c(C)nn(C)c1OC |
| InChI | InChI=1S/C13H24N2O2/c1-6-10(7-2)8-11(16)12-9(3)14-15(4)13(12)17-5/h10-11,16H,6-8H2,1-5H3 |
| InChIKey | LPZRNXSAAQBDOS-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |