About 1-[(3,4-difluorophenyl)methyl]-1,4-diazepan-2-one
1-[(3,4-difluorophenyl)methyl]-1,4-diazepan-2-one (PubChem CID 82930342) has the molecular formula C12H14F2N2O
and a molecular weight of 240.25 g/mol. Its IUPAC name is 1-[(3,4-difluorophenyl)methyl]-1,4-diazepan-2-one.
Molecular Properties
| Compound Name | 1-[(3,4-difluorophenyl)methyl]-1,4-diazepan-2-one |
| PubChem CID | 82930342 |
| Molecular Formula | C12H14F2N2O |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 1-[(3,4-difluorophenyl)methyl]-1,4-diazepan-2-one |
| SMILES | O=C1CNCCCN1Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H14F2N2O/c13-10-3-2-9(6-11(10)14)8-16-5-1-4-15-7-12(16)17/h2-3,6,15H,1,4-5,7-8H2 |
| InChIKey | YOFBRUFVNNUTCC-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(3,4-difluorophenyl)methyl]-1,4-diazepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3,4-difluorophenyl)methyl]-1,4-diazepan-2-one?
The IUPAC name of 1-[(3,4-difluorophenyl)methyl]-1,4-diazepan-2-one (CID 82930342) is 1-[(3,4-difluorophenyl)methyl]-1,4-diazepan-2-one.
What is the SMILES notation for 1-[(3,4-difluorophenyl)methyl]-1,4-diazepan-2-one?
The canonical SMILES for 1-[(3,4-difluorophenyl)methyl]-1,4-diazepan-2-one is O=C1CNCCCN1Cc1ccc(F)c(F)c1.
What is the InChIKey of 1-[(3,4-difluorophenyl)methyl]-1,4-diazepan-2-one?
The InChIKey is YOFBRUFVNNUTCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14F2N2O/c13-10-3-2-9(6-11(10)14)8-16-5-1-4-15-7-12(16)17/h2-3,6,15H,1,4-5,7-8H2.
What are the key properties of 1-[(3,4-difluorophenyl)methyl]-1,4-diazepan-2-one?
1-[(3,4-difluorophenyl)methyl]-1,4-diazepan-2-one has a molecular weight of 240.25 g/mol, XLogP of 1.29, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,4-difluorophenyl)methyl]-1,4-diazepan-2-one is sourced from PubChem (CID 82930342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).