C15H28N2O — CID 82932302
3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl(cycloheptyl)methanamine (PubChem CID 82932302) has the molecular formula C15H28N2O and a molecular weight of 252.40 g/mol. Its IUPAC name is 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl(cycloheptyl)methanamine.
| Compound Name | 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl(cycloheptyl)methanamine |
|---|---|
| PubChem CID | 82932302 |
| Molecular Formula | C15H28N2O |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.22 |
| IUPAC Name | 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl(cycloheptyl)methanamine |
| SMILES | NC(C1CCCCCC1)C1CN2CCCC2CO1 |
| InChI | InChI=1S/C15H28N2O/c16-15(12-6-3-1-2-4-7-12)14-10-17-9-5-8-13(17)11-18-14/h12-15H,1-11,16H2 |
| InChIKey | DQSIALPRRXHPNN-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |