About N-[cycloheptyl(1,4-dithian-2-yl)methyl]ethanamine
N-[cycloheptyl(1,4-dithian-2-yl)methyl]ethanamine (PubChem CID 82932401) has the molecular formula C14H27NS2
and a molecular weight of 273.51 g/mol. Its IUPAC name is N-[cycloheptyl(1,4-dithian-2-yl)methyl]ethanamine.
Molecular Properties
| Compound Name | N-[cycloheptyl(1,4-dithian-2-yl)methyl]ethanamine |
| PubChem CID | 82932401 |
| Molecular Formula | C14H27NS2 |
| Molecular Weight | 273.51 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | N-[cycloheptyl(1,4-dithian-2-yl)methyl]ethanamine |
| SMILES | CCNC(C1CCCCCC1)C1CSCCS1 |
| InChI | InChI=1S/C14H27NS2/c1-2-15-14(13-11-16-9-10-17-13)12-7-5-3-4-6-8-12/h12-15H,2-11H2,1H3 |
| InChIKey | TXUCYNDDEMWSAB-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.51 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[cycloheptyl(1,4-dithian-2-yl)methyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[cycloheptyl(1,4-dithian-2-yl)methyl]ethanamine?
The IUPAC name of N-[cycloheptyl(1,4-dithian-2-yl)methyl]ethanamine (CID 82932401) is N-[cycloheptyl(1,4-dithian-2-yl)methyl]ethanamine.
What is the SMILES notation for N-[cycloheptyl(1,4-dithian-2-yl)methyl]ethanamine?
The canonical SMILES for N-[cycloheptyl(1,4-dithian-2-yl)methyl]ethanamine is CCNC(C1CCCCCC1)C1CSCCS1.
What is the InChIKey of N-[cycloheptyl(1,4-dithian-2-yl)methyl]ethanamine?
The InChIKey is TXUCYNDDEMWSAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27NS2/c1-2-15-14(13-11-16-9-10-17-13)12-7-5-3-4-6-8-12/h12-15H,2-11H2,1H3.
What are the key properties of N-[cycloheptyl(1,4-dithian-2-yl)methyl]ethanamine?
N-[cycloheptyl(1,4-dithian-2-yl)methyl]ethanamine has a molecular weight of 273.51 g/mol, XLogP of 3.78, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[cycloheptyl(1,4-dithian-2-yl)methyl]ethanamine is sourced from PubChem (CID 82932401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).