C17H24F3N — CID 82932686
N-[cycloheptyl-(3,4,5-trifluorophenyl)methyl]propan-1-amine (PubChem CID 82932686) has the molecular formula C17H24F3N and a molecular weight of 299.38 g/mol. Its IUPAC name is N-[cycloheptyl-(3,4,5-trifluorophenyl)methyl]propan-1-amine.
| Compound Name | N-[cycloheptyl-(3,4,5-trifluorophenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 82932686 |
| Molecular Formula | C17H24F3N |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | N-[cycloheptyl-(3,4,5-trifluorophenyl)methyl]propan-1-amine |
| SMILES | CCCNC(c1cc(F)c(F)c(F)c1)C1CCCCCC1 |
| InChI | InChI=1S/C17H24F3N/c1-2-9-21-17(12-7-5-3-4-6-8-12)13-10-14(18)16(20)15(19)11-13/h10-12,17,21H,2-9H2,1H3 |
| InChIKey | LOLBGKVQMCCEHH-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|