2-[(cyclopentylamino)methyl]pentanoic acid

C11H21NO2 — CID 82933542

IUPAC2-[(cyclopentylamino)methyl]pentanoic acid
SMILESCCCC(CNC1CCCC1)C(=O)O
InChIInChI=1S/C11H21NO2/c1-2-5-9(11(13)14)8-12-10-6-3-4-7-10/h9-10,12H,2-8H2,1H3,(H,13,14)
InChIKeyRKCIWIMHYLSVFM-UHFFFAOYSA-N
MW199.29 g/mol
LogP2.02
Rot. Bonds6

About 2-[(cyclopentylamino)methyl]pentanoic acid

2-[(cyclopentylamino)methyl]pentanoic acid (PubChem CID 82933542) has the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. Its IUPAC name is 2-[(cyclopentylamino)methyl]pentanoic acid.

Molecular Properties

Compound Name2-[(cyclopentylamino)methyl]pentanoic acid
PubChem CID82933542
Molecular FormulaC11H21NO2
Molecular Weight199.29 g/mol
Exact Mass199.16
IUPAC Name2-[(cyclopentylamino)methyl]pentanoic acid
SMILESCCCC(CNC1CCCC1)C(=O)O
InChIInChI=1S/C11H21NO2/c1-2-5-9(11(13)14)8-12-10-6-3-4-7-10/h9-10,12H,2-8H2,1H3,(H,13,14)
InChIKeyRKCIWIMHYLSVFM-UHFFFAOYSA-N
XLogP2.02
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500199.29
LogP ≤ 52.02
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-[(cyclopentylamino)methyl]pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-[2-(cycloheptylamino)-2-oxoethyl]pentanoic acid
CID 112516456
methyl 2-[(cyclopentylamino)methyl]hexanoate
CID 174575795
2-[[(3-methylcyclohexyl)carbamoylamino]methyl]pentanoic acid
CID 65223457
2-[(2-cyclopentyloxyethylcarbamoylamino)methyl]pentanoic acid
CID 65226423
2-[[3-(cyclopentanecarbonylamino)propanoylamino]methyl]pentanoic acid
CID 65219035
2-amino-3-(cyclohexylamino)propanoic acid
CID 64582225
2-[[[2-(trifluoromethyl)cyclohexanecarbonyl]amino]methyl]pentanoic acid
CID 104621999
2-[[[(2-hydroxycyclohexyl)-methylcarbamoyl]amino]methyl]pentanoic acid
CID 102633495
2-[(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carbonylamino)methyl]pentanoic acid
CID 65223617
2-[(cyclobutylamino)methyl]pentan-1-ol
CID 117241776
acetic acid;ethyl 3-(cyclohexylamino)-2-methylpropanoate
CID 68737349
5-(cyclohexylamino)-4-methylpentanoic acid
CID 82933568

Frequently Asked Questions

What is the IUPAC name of 2-[(cyclopentylamino)methyl]pentanoic acid?
The IUPAC name of 2-[(cyclopentylamino)methyl]pentanoic acid (CID 82933542) is 2-[(cyclopentylamino)methyl]pentanoic acid.
What is the SMILES notation for 2-[(cyclopentylamino)methyl]pentanoic acid?
The canonical SMILES for 2-[(cyclopentylamino)methyl]pentanoic acid is CCCC(CNC1CCCC1)C(=O)O.
What is the InChIKey of 2-[(cyclopentylamino)methyl]pentanoic acid?
The InChIKey is RKCIWIMHYLSVFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO2/c1-2-5-9(11(13)14)8-12-10-6-3-4-7-10/h9-10,12H,2-8H2,1H3,(H,13,14).
What are the key properties of 2-[(cyclopentylamino)methyl]pentanoic acid?
2-[(cyclopentylamino)methyl]pentanoic acid has a molecular weight of 199.29 g/mol, XLogP of 2.02, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(cyclopentylamino)methyl]pentanoic acid is sourced from PubChem (CID 82933542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).