C16H24N2 — CID 82933808
N-cycloheptyl-1,2,3,4-tetrahydroquinolin-7-amine (PubChem CID 82933808) has the molecular formula C16H24N2 and a molecular weight of 244.38 g/mol. Its IUPAC name is N-cycloheptyl-1,2,3,4-tetrahydroquinolin-7-amine.
| Compound Name | N-cycloheptyl-1,2,3,4-tetrahydroquinolin-7-amine |
|---|---|
| PubChem CID | 82933808 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | N-cycloheptyl-1,2,3,4-tetrahydroquinolin-7-amine |
| SMILES | c1cc2c(cc1NC1CCCCCC1)NCCC2 |
| InChI | InChI=1S/C16H24N2/c1-2-4-8-14(7-3-1)18-15-10-9-13-6-5-11-17-16(13)12-15/h9-10,12,14,17-18H,1-8,11H2 |
| InChIKey | CMNKXJLGERAOIO-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |