About 5-ethyl-2,3-dimethyl-N-propan-2-ylheptan-1-amine
5-ethyl-2,3-dimethyl-N-propan-2-ylheptan-1-amine (PubChem CID 82934817) has the molecular formula C14H31N
and a molecular weight of 213.41 g/mol. Its IUPAC name is 5-ethyl-2,3-dimethyl-N-propan-2-ylheptan-1-amine.
Molecular Properties
| Compound Name | 5-ethyl-2,3-dimethyl-N-propan-2-ylheptan-1-amine |
| PubChem CID | 82934817 |
| Molecular Formula | C14H31N |
| Molecular Weight | 213.41 g/mol |
| Exact Mass | 213.25 |
| IUPAC Name | 5-ethyl-2,3-dimethyl-N-propan-2-ylheptan-1-amine |
| SMILES | CCC(CC)CC(C)C(C)CNC(C)C |
| InChI | InChI=1S/C14H31N/c1-7-14(8-2)9-12(5)13(6)10-15-11(3)4/h11-15H,7-10H2,1-6H3 |
| InChIKey | RNBHBNLXEGOWDA-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.41 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-ethyl-2,3-dimethyl-N-propan-2-ylheptan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-2,3-dimethyl-N-propan-2-ylheptan-1-amine?
The IUPAC name of 5-ethyl-2,3-dimethyl-N-propan-2-ylheptan-1-amine (CID 82934817) is 5-ethyl-2,3-dimethyl-N-propan-2-ylheptan-1-amine.
What is the SMILES notation for 5-ethyl-2,3-dimethyl-N-propan-2-ylheptan-1-amine?
The canonical SMILES for 5-ethyl-2,3-dimethyl-N-propan-2-ylheptan-1-amine is CCC(CC)CC(C)C(C)CNC(C)C.
What is the InChIKey of 5-ethyl-2,3-dimethyl-N-propan-2-ylheptan-1-amine?
The InChIKey is RNBHBNLXEGOWDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H31N/c1-7-14(8-2)9-12(5)13(6)10-15-11(3)4/h11-15H,7-10H2,1-6H3.
What are the key properties of 5-ethyl-2,3-dimethyl-N-propan-2-ylheptan-1-amine?
5-ethyl-2,3-dimethyl-N-propan-2-ylheptan-1-amine has a molecular weight of 213.41 g/mol, XLogP of 4.08, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-2,3-dimethyl-N-propan-2-ylheptan-1-amine is sourced from PubChem (CID 82934817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).