C18H36N2 — CID 82936429
1-cycloheptyl-2,2-diethyl-5-propylpiperazine (PubChem CID 82936429) has the molecular formula C18H36N2 and a molecular weight of 280.50 g/mol. Its IUPAC name is 1-cycloheptyl-2,2-diethyl-5-propylpiperazine.
| Compound Name | 1-cycloheptyl-2,2-diethyl-5-propylpiperazine |
|---|---|
| PubChem CID | 82936429 |
| Molecular Formula | C18H36N2 |
| Molecular Weight | 280.50 g/mol |
| Exact Mass | 280.29 |
| IUPAC Name | 1-cycloheptyl-2,2-diethyl-5-propylpiperazine |
| SMILES | CCCC1CN(C2CCCCCC2)C(CC)(CC)CN1 |
| InChI | InChI=1S/C18H36N2/c1-4-11-16-14-20(17-12-9-7-8-10-13-17)18(5-2,6-3)15-19-16/h16-17,19H,4-15H2,1-3H3 |
| InChIKey | KGSHYRUURSGLPR-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.50 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |