About 2-cyclohexyl-2-(1,1-dioxothiolan-3-yl)ethanol
2-cyclohexyl-2-(1,1-dioxothiolan-3-yl)ethanol (PubChem CID 82936974) has the molecular formula C12H22O3S
and a molecular weight of 246.37 g/mol. Its IUPAC name is 2-cyclohexyl-2-(1,1-dioxothiolan-3-yl)ethanol.
Molecular Properties
| Compound Name | 2-cyclohexyl-2-(1,1-dioxothiolan-3-yl)ethanol |
| PubChem CID | 82936974 |
| Molecular Formula | C12H22O3S |
| Molecular Weight | 246.37 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | 2-cyclohexyl-2-(1,1-dioxothiolan-3-yl)ethanol |
| SMILES | O=S1(=O)CCC(C(CO)C2CCCCC2)C1 |
| InChI | InChI=1S/C12H22O3S/c13-8-12(10-4-2-1-3-5-10)11-6-7-16(14,15)9-11/h10-13H,1-9H2 |
| InChIKey | SRGYHFLTZIEMHD-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.37 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-cyclohexyl-2-(1,1-dioxothiolan-3-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyl-2-(1,1-dioxothiolan-3-yl)ethanol?
The IUPAC name of 2-cyclohexyl-2-(1,1-dioxothiolan-3-yl)ethanol (CID 82936974) is 2-cyclohexyl-2-(1,1-dioxothiolan-3-yl)ethanol.
What is the SMILES notation for 2-cyclohexyl-2-(1,1-dioxothiolan-3-yl)ethanol?
The canonical SMILES for 2-cyclohexyl-2-(1,1-dioxothiolan-3-yl)ethanol is O=S1(=O)CCC(C(CO)C2CCCCC2)C1.
What is the InChIKey of 2-cyclohexyl-2-(1,1-dioxothiolan-3-yl)ethanol?
The InChIKey is SRGYHFLTZIEMHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O3S/c13-8-12(10-4-2-1-3-5-10)11-6-7-16(14,15)9-11/h10-13H,1-9H2.
What are the key properties of 2-cyclohexyl-2-(1,1-dioxothiolan-3-yl)ethanol?
2-cyclohexyl-2-(1,1-dioxothiolan-3-yl)ethanol has a molecular weight of 246.37 g/mol, XLogP of 1.61, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-2-(1,1-dioxothiolan-3-yl)ethanol is sourced from PubChem (CID 82936974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).