About (2-methylphenyl) pyridine-3-carboxylate
(2-methylphenyl) pyridine-3-carboxylate (PubChem CID 829373) has the molecular formula C13H11NO2
and a molecular weight of 213.24 g/mol. Its IUPAC name is (2-methylphenyl) pyridine-3-carboxylate.
Molecular Properties
| Compound Name | (2-methylphenyl) pyridine-3-carboxylate |
| PubChem CID | 829373 |
| Molecular Formula | C13H11NO2 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | (2-methylphenyl) pyridine-3-carboxylate |
| SMILES | Cc1ccccc1OC(=O)c1cccnc1 |
| InChI | InChI=1S/C13H11NO2/c1-10-5-2-3-7-12(10)16-13(15)11-6-4-8-14-9-11/h2-9H,1H3 |
| InChIKey | TVPAWAZKOGPPAE-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-methylphenyl) pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylphenyl) pyridine-3-carboxylate?
The IUPAC name of (2-methylphenyl) pyridine-3-carboxylate (CID 829373) is (2-methylphenyl) pyridine-3-carboxylate.
What is the SMILES notation for (2-methylphenyl) pyridine-3-carboxylate?
The canonical SMILES for (2-methylphenyl) pyridine-3-carboxylate is Cc1ccccc1OC(=O)c1cccnc1.
What is the InChIKey of (2-methylphenyl) pyridine-3-carboxylate?
The InChIKey is TVPAWAZKOGPPAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO2/c1-10-5-2-3-7-12(10)16-13(15)11-6-4-8-14-9-11/h2-9H,1H3.
What are the key properties of (2-methylphenyl) pyridine-3-carboxylate?
(2-methylphenyl) pyridine-3-carboxylate has a molecular weight of 213.24 g/mol, XLogP of 2.61, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylphenyl) pyridine-3-carboxylate is sourced from PubChem (CID 829373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).