About 2-N-(2-cyclopropylethyl)-1-N,1-N-dimethylpropane-1,2-diamine
2-N-(2-cyclopropylethyl)-1-N,1-N-dimethylpropane-1,2-diamine (PubChem CID 82937931) has the molecular formula C10H22N2
and a molecular weight of 170.30 g/mol. Its IUPAC name is 2-N-(2-cyclopropylethyl)-1-N,1-N-dimethylpropane-1,2-diamine.
Molecular Properties
| Compound Name | 2-N-(2-cyclopropylethyl)-1-N,1-N-dimethylpropane-1,2-diamine |
| PubChem CID | 82937931 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | 2-N-(2-cyclopropylethyl)-1-N,1-N-dimethylpropane-1,2-diamine |
| SMILES | CC(CN(C)C)NCCC1CC1 |
| InChI | InChI=1S/C10H22N2/c1-9(8-12(2)3)11-7-6-10-4-5-10/h9-11H,4-8H2,1-3H3 |
| InChIKey | WNCUPIHRRRTPNR-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-N-(2-cyclopropylethyl)-1-N,1-N-dimethylpropane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-(2-cyclopropylethyl)-1-N,1-N-dimethylpropane-1,2-diamine?
The IUPAC name of 2-N-(2-cyclopropylethyl)-1-N,1-N-dimethylpropane-1,2-diamine (CID 82937931) is 2-N-(2-cyclopropylethyl)-1-N,1-N-dimethylpropane-1,2-diamine.
What is the SMILES notation for 2-N-(2-cyclopropylethyl)-1-N,1-N-dimethylpropane-1,2-diamine?
The canonical SMILES for 2-N-(2-cyclopropylethyl)-1-N,1-N-dimethylpropane-1,2-diamine is CC(CN(C)C)NCCC1CC1.
What is the InChIKey of 2-N-(2-cyclopropylethyl)-1-N,1-N-dimethylpropane-1,2-diamine?
The InChIKey is WNCUPIHRRRTPNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N2/c1-9(8-12(2)3)11-7-6-10-4-5-10/h9-11H,4-8H2,1-3H3.
What are the key properties of 2-N-(2-cyclopropylethyl)-1-N,1-N-dimethylpropane-1,2-diamine?
2-N-(2-cyclopropylethyl)-1-N,1-N-dimethylpropane-1,2-diamine has a molecular weight of 170.30 g/mol, XLogP of 1.33, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-(2-cyclopropylethyl)-1-N,1-N-dimethylpropane-1,2-diamine is sourced from PubChem (CID 82937931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).