C14H14Cl2O3 — CID 829394
(3R,6S)-6-(2,4-dichlorophenyl)-3,5,5-trimethyloxane-2,4-dione (PubChem CID 829394) has the molecular formula C14H14Cl2O3 and a molecular weight of 301.17 g/mol. Its IUPAC name is (3R,6S)-6-(2,4-dichlorophenyl)-3,5,5-trimethyloxane-2,4-dione.
| Compound Name | (3R,6S)-6-(2,4-dichlorophenyl)-3,5,5-trimethyloxane-2,4-dione |
|---|---|
| PubChem CID | 829394 |
| Molecular Formula | C14H14Cl2O3 |
| Molecular Weight | 301.17 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | (3R,6S)-6-(2,4-dichlorophenyl)-3,5,5-trimethyloxane-2,4-dione |
| SMILES | C[C@H]1C(=O)O[C@H](c2ccc(Cl)cc2Cl)C(C)(C)C1=O |
| InChI | InChI=1S/C14H14Cl2O3/c1-7-11(17)14(2,3)12(19-13(7)18)9-5-4-8(15)6-10(9)16/h4-7,12H,1-3H3/t7-,12-/m1/s1 |
| InChIKey | XQENWXGXIYCFMK-JMCQJSRRSA-N |
| XLogP | 3.82 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.17 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|