C15H21N3O2S — CID 82940267
2-[1-[1-(dimethylamino)propan-2-yl]-5-methylbenzimidazol-2-yl]sulfanylacetic acid (PubChem CID 82940267) has the molecular formula C15H21N3O2S and a molecular weight of 307.42 g/mol. Its IUPAC name is 2-[1-[1-(dimethylamino)propan-2-yl]-5-methylbenzimidazol-2-yl]sulfanylacetic acid.
| Compound Name | 2-[1-[1-(dimethylamino)propan-2-yl]-5-methylbenzimidazol-2-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 82940267 |
| Molecular Formula | C15H21N3O2S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 2-[1-[1-(dimethylamino)propan-2-yl]-5-methylbenzimidazol-2-yl]sulfanylacetic acid |
| SMILES | Cc1ccc2c(c1)nc(SCC(=O)O)n2C(C)CN(C)C |
| InChI | InChI=1S/C15H21N3O2S/c1-10-5-6-13-12(7-10)16-15(21-9-14(19)20)18(13)11(2)8-17(3)4/h5-7,11H,8-9H2,1-4H3,(H,19,20) |
| InChIKey | VUASOHOVBKZVPG-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |