About 2-N-(3-propoxypropyl)-1,3-benzoxazole-2,4-diamine
2-N-(3-propoxypropyl)-1,3-benzoxazole-2,4-diamine (PubChem CID 82940553) has the molecular formula C13H19N3O2
and a molecular weight of 249.31 g/mol. Its IUPAC name is 2-N-(3-propoxypropyl)-1,3-benzoxazole-2,4-diamine.
Molecular Properties
| Compound Name | 2-N-(3-propoxypropyl)-1,3-benzoxazole-2,4-diamine |
| PubChem CID | 82940553 |
| Molecular Formula | C13H19N3O2 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 2-N-(3-propoxypropyl)-1,3-benzoxazole-2,4-diamine |
| SMILES | CCCOCCCNc1nc2c(N)cccc2o1 |
| InChI | InChI=1S/C13H19N3O2/c1-2-8-17-9-4-7-15-13-16-12-10(14)5-3-6-11(12)18-13/h3,5-6H,2,4,7-9,14H2,1H3,(H,15,16) |
| InChIKey | FQMYNTVRJCKOGV-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 73.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-N-(3-propoxypropyl)-1,3-benzoxazole-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-(3-propoxypropyl)-1,3-benzoxazole-2,4-diamine?
The IUPAC name of 2-N-(3-propoxypropyl)-1,3-benzoxazole-2,4-diamine (CID 82940553) is 2-N-(3-propoxypropyl)-1,3-benzoxazole-2,4-diamine.
What is the SMILES notation for 2-N-(3-propoxypropyl)-1,3-benzoxazole-2,4-diamine?
The canonical SMILES for 2-N-(3-propoxypropyl)-1,3-benzoxazole-2,4-diamine is CCCOCCCNc1nc2c(N)cccc2o1.
What is the InChIKey of 2-N-(3-propoxypropyl)-1,3-benzoxazole-2,4-diamine?
The InChIKey is FQMYNTVRJCKOGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3O2/c1-2-8-17-9-4-7-15-13-16-12-10(14)5-3-6-11(12)18-13/h3,5-6H,2,4,7-9,14H2,1H3,(H,15,16).
What are the key properties of 2-N-(3-propoxypropyl)-1,3-benzoxazole-2,4-diamine?
2-N-(3-propoxypropyl)-1,3-benzoxazole-2,4-diamine has a molecular weight of 249.31 g/mol, XLogP of 2.64, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-(3-propoxypropyl)-1,3-benzoxazole-2,4-diamine is sourced from PubChem (CID 82940553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).