C16H32N2O3 — CID 82941282
ethyl 1-amino-2-[2-[2-methoxyethyl(propan-2-yl)amino]ethyl]cyclopentane-1-carboxylate (PubChem CID 82941282) has the molecular formula C16H32N2O3 and a molecular weight of 300.44 g/mol. Its IUPAC name is ethyl 1-amino-2-[2-[2-methoxyethyl(propan-2-yl)amino]ethyl]cyclopentane-1-carboxylate.
| Compound Name | ethyl 1-amino-2-[2-[2-methoxyethyl(propan-2-yl)amino]ethyl]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 82941282 |
| Molecular Formula | C16H32N2O3 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.24 |
| IUPAC Name | ethyl 1-amino-2-[2-[2-methoxyethyl(propan-2-yl)amino]ethyl]cyclopentane-1-carboxylate |
| SMILES | CCOC(=O)C1(N)CCCC1CCN(CCOC)C(C)C |
| InChI | InChI=1S/C16H32N2O3/c1-5-21-15(19)16(17)9-6-7-14(16)8-10-18(13(2)3)11-12-20-4/h13-14H,5-12,17H2,1-4H3 |
| InChIKey | AFSGPPKTSOMKIQ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |