C14H19ClN2O4 — CID 82942351
4-chloro-2-(3-propoxypropylcarbamoylamino)benzoic acid (PubChem CID 82942351) has the molecular formula C14H19ClN2O4 and a molecular weight of 314.77 g/mol. Its IUPAC name is 4-chloro-2-(3-propoxypropylcarbamoylamino)benzoic acid.
| Compound Name | 4-chloro-2-(3-propoxypropylcarbamoylamino)benzoic acid |
|---|---|
| PubChem CID | 82942351 |
| Molecular Formula | C14H19ClN2O4 |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 4-chloro-2-(3-propoxypropylcarbamoylamino)benzoic acid |
| SMILES | CCCOCCCNC(=O)Nc1cc(Cl)ccc1C(=O)O |
| InChI | InChI=1S/C14H19ClN2O4/c1-2-7-21-8-3-6-16-14(20)17-12-9-10(15)4-5-11(12)13(18)19/h4-5,9H,2-3,6-8H2,1H3,(H,18,19)(H2,16,17,20) |
| InChIKey | SCFDKZIRWYGDDY-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|