C14H17F3N2OS — CID 82942367
3-(3-propoxypropyl)-6-(trifluoromethyl)-1H-benzimidazole-2-thione (PubChem CID 82942367) has the molecular formula C14H17F3N2OS and a molecular weight of 318.36 g/mol. Its IUPAC name is 3-(3-propoxypropyl)-6-(trifluoromethyl)-1H-benzimidazole-2-thione.
| Compound Name | 3-(3-propoxypropyl)-6-(trifluoromethyl)-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 82942367 |
| Molecular Formula | C14H17F3N2OS |
| Molecular Weight | 318.36 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 3-(3-propoxypropyl)-6-(trifluoromethyl)-1H-benzimidazole-2-thione |
| SMILES | CCCOCCCn1c(=S)[nH]c2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C14H17F3N2OS/c1-2-7-20-8-3-6-19-12-5-4-10(14(15,16)17)9-11(12)18-13(19)21/h4-5,9H,2-3,6-8H2,1H3,(H,18,21) |
| InChIKey | WFWUEHMTLUSPQO-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 29.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.36 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|