C15H29N3O2S — CID 82943284
N,N-bis(2-ethoxyethyl)-4-ethyl-5-(methylaminomethyl)-1,3-thiazol-2-amine (PubChem CID 82943284) has the molecular formula C15H29N3O2S and a molecular weight of 315.48 g/mol. Its IUPAC name is N,N-bis(2-ethoxyethyl)-4-ethyl-5-(methylaminomethyl)-1,3-thiazol-2-amine.
| Compound Name | N,N-bis(2-ethoxyethyl)-4-ethyl-5-(methylaminomethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 82943284 |
| Molecular Formula | C15H29N3O2S |
| Molecular Weight | 315.48 g/mol |
| Exact Mass | 315.20 |
| IUPAC Name | N,N-bis(2-ethoxyethyl)-4-ethyl-5-(methylaminomethyl)-1,3-thiazol-2-amine |
| SMILES | CCOCCN(CCOCC)c1nc(CC)c(CNC)s1 |
| InChI | InChI=1S/C15H29N3O2S/c1-5-13-14(12-16-4)21-15(17-13)18(8-10-19-6-2)9-11-20-7-3/h16H,5-12H2,1-4H3 |
| InChIKey | MRKRTKQCCIESQB-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.48 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|