C17H36N2O2 — CID 82944024
N',N'-bis(2-ethoxyethyl)-N-(3-methylcyclohexyl)ethane-1,2-diamine (PubChem CID 82944024) has the molecular formula C17H36N2O2 and a molecular weight of 300.49 g/mol. Its IUPAC name is N',N'-bis(2-ethoxyethyl)-N-(3-methylcyclohexyl)ethane-1,2-diamine.
| Compound Name | N',N'-bis(2-ethoxyethyl)-N-(3-methylcyclohexyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 82944024 |
| Molecular Formula | C17H36N2O2 |
| Molecular Weight | 300.49 g/mol |
| Exact Mass | 300.28 |
| IUPAC Name | N',N'-bis(2-ethoxyethyl)-N-(3-methylcyclohexyl)ethane-1,2-diamine |
| SMILES | CCOCCN(CCNC1CCCC(C)C1)CCOCC |
| InChI | InChI=1S/C17H36N2O2/c1-4-20-13-11-19(12-14-21-5-2)10-9-18-17-8-6-7-16(3)15-17/h16-18H,4-15H2,1-3H3 |
| InChIKey | DVYFZMWMIOOLDM-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.49 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|