C13H18Cl2FNO3S — CID 82944052
4-chloro-3-(chloromethyl)-5-fluoro-N-(2-methoxyethyl)-N-propan-2-ylbenzenesulfonamide (PubChem CID 82944052) has the molecular formula C13H18Cl2FNO3S and a molecular weight of 358.26 g/mol. Its IUPAC name is 4-chloro-3-(chloromethyl)-5-fluoro-N-(2-methoxyethyl)-N-propan-2-ylbenzenesulfonamide.
| Compound Name | 4-chloro-3-(chloromethyl)-5-fluoro-N-(2-methoxyethyl)-N-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 82944052 |
| Molecular Formula | C13H18Cl2FNO3S |
| Molecular Weight | 358.26 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | 4-chloro-3-(chloromethyl)-5-fluoro-N-(2-methoxyethyl)-N-propan-2-ylbenzenesulfonamide |
| SMILES | COCCN(C(C)C)S(=O)(=O)c1cc(F)c(Cl)c(CCl)c1 |
| InChI | InChI=1S/C13H18Cl2FNO3S/c1-9(2)17(4-5-20-3)21(18,19)11-6-10(8-14)13(15)12(16)7-11/h6-7,9H,4-5,8H2,1-3H3 |
| InChIKey | KSUIKHPGLBPTFQ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.26 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|