About 5-(3-propoxypropylamino)-3H-1,3,4-thiadiazole-2-thione
5-(3-propoxypropylamino)-3H-1,3,4-thiadiazole-2-thione (PubChem CID 82944099) has the molecular formula C8H15N3OS2
and a molecular weight of 233.36 g/mol. Its IUPAC name is 5-(3-propoxypropylamino)-3H-1,3,4-thiadiazole-2-thione.
Molecular Properties
| Compound Name | 5-(3-propoxypropylamino)-3H-1,3,4-thiadiazole-2-thione |
| PubChem CID | 82944099 |
| Molecular Formula | C8H15N3OS2 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 5-(3-propoxypropylamino)-3H-1,3,4-thiadiazole-2-thione |
| SMILES | CCCOCCCNc1n[nH]c(=S)s1 |
| InChI | InChI=1S/C8H15N3OS2/c1-2-5-12-6-3-4-9-7-10-11-8(13)14-7/h2-6H2,1H3,(H,9,10)(H,11,13) |
| InChIKey | MFLSRUUVVWEBDV-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-(3-propoxypropylamino)-3H-1,3,4-thiadiazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-propoxypropylamino)-3H-1,3,4-thiadiazole-2-thione?
The IUPAC name of 5-(3-propoxypropylamino)-3H-1,3,4-thiadiazole-2-thione (CID 82944099) is 5-(3-propoxypropylamino)-3H-1,3,4-thiadiazole-2-thione.
What is the SMILES notation for 5-(3-propoxypropylamino)-3H-1,3,4-thiadiazole-2-thione?
The canonical SMILES for 5-(3-propoxypropylamino)-3H-1,3,4-thiadiazole-2-thione is CCCOCCCNc1n[nH]c(=S)s1.
What is the InChIKey of 5-(3-propoxypropylamino)-3H-1,3,4-thiadiazole-2-thione?
The InChIKey is MFLSRUUVVWEBDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3OS2/c1-2-5-12-6-3-4-9-7-10-11-8(13)14-7/h2-6H2,1H3,(H,9,10)(H,11,13).
What are the key properties of 5-(3-propoxypropylamino)-3H-1,3,4-thiadiazole-2-thione?
5-(3-propoxypropylamino)-3H-1,3,4-thiadiazole-2-thione has a molecular weight of 233.36 g/mol, XLogP of 2.43, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-propoxypropylamino)-3H-1,3,4-thiadiazole-2-thione is sourced from PubChem (CID 82944099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).