C16H36N2O3 — CID 82944529
4-[bis(2-ethoxyethyl)amino]-2-(ethylamino)-2-methylpentan-1-ol (PubChem CID 82944529) has the molecular formula C16H36N2O3 and a molecular weight of 304.48 g/mol. Its IUPAC name is 4-[bis(2-ethoxyethyl)amino]-2-(ethylamino)-2-methylpentan-1-ol.
| Compound Name | 4-[bis(2-ethoxyethyl)amino]-2-(ethylamino)-2-methylpentan-1-ol |
|---|---|
| PubChem CID | 82944529 |
| Molecular Formula | C16H36N2O3 |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.27 |
| IUPAC Name | 4-[bis(2-ethoxyethyl)amino]-2-(ethylamino)-2-methylpentan-1-ol |
| SMILES | CCNC(C)(CO)CC(C)N(CCOCC)CCOCC |
| InChI | InChI=1S/C16H36N2O3/c1-6-17-16(5,14-19)13-15(4)18(9-11-20-7-2)10-12-21-8-3/h15,17,19H,6-14H2,1-5H3 |
| InChIKey | RSDIHLDOCYKMIB-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|