C11H23N3O — CID 82945148
(3R)-N-[1-(dimethylamino)propan-2-yl]piperidine-3-carboxamide (PubChem CID 82945148) has the molecular formula C11H23N3O and a molecular weight of 213.32 g/mol. Its IUPAC name is (3R)-N-[1-(dimethylamino)propan-2-yl]piperidine-3-carboxamide.
| Compound Name | (3R)-N-[1-(dimethylamino)propan-2-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 82945148 |
| Molecular Formula | C11H23N3O |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.18 |
| IUPAC Name | (3R)-N-[1-(dimethylamino)propan-2-yl]piperidine-3-carboxamide |
| SMILES | CC(CN(C)C)NC(=O)[C@@H]1CCCNC1 |
| InChI | InChI=1S/C11H23N3O/c1-9(8-14(2)3)13-11(15)10-5-4-6-12-7-10/h9-10,12H,4-8H2,1-3H3,(H,13,15)/t9?,10-/m1/s1 |
| InChIKey | QKVIKFAINNEKBL-QVDQXJPCSA-N |
| XLogP | 0.05 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |