C10H23N3O2 — CID 82945682
2-amino-N-[1-(dimethylamino)propan-2-yl]-4-methoxybutanamide (PubChem CID 82945682) has the molecular formula C10H23N3O2 and a molecular weight of 217.31 g/mol. Its IUPAC name is 2-amino-N-[1-(dimethylamino)propan-2-yl]-4-methoxybutanamide.
| Compound Name | 2-amino-N-[1-(dimethylamino)propan-2-yl]-4-methoxybutanamide |
|---|---|
| PubChem CID | 82945682 |
| Molecular Formula | C10H23N3O2 |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | 2-amino-N-[1-(dimethylamino)propan-2-yl]-4-methoxybutanamide |
| SMILES | COCCC(N)C(=O)NC(C)CN(C)C |
| InChI | InChI=1S/C10H23N3O2/c1-8(7-13(2)3)12-10(14)9(11)5-6-15-4/h8-9H,5-7,11H2,1-4H3,(H,12,14) |
| InChIKey | FUGVFTPWUIZBPT-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |