About [2-(4,6-dimethyl-1H-benzimidazol-2-yl)cyclopentyl]methanamine
[2-(4,6-dimethyl-1H-benzimidazol-2-yl)cyclopentyl]methanamine (PubChem CID 82946852) has the molecular formula C15H21N3
and a molecular weight of 243.35 g/mol. Its IUPAC name is [2-(4,6-dimethyl-1H-benzimidazol-2-yl)cyclopentyl]methanamine.
Molecular Properties
| Compound Name | [2-(4,6-dimethyl-1H-benzimidazol-2-yl)cyclopentyl]methanamine |
| PubChem CID | 82946852 |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | [2-(4,6-dimethyl-1H-benzimidazol-2-yl)cyclopentyl]methanamine |
| SMILES | Cc1cc(C)c2nc(C3CCCC3CN)[nH]c2c1 |
| InChI | InChI=1S/C15H21N3/c1-9-6-10(2)14-13(7-9)17-15(18-14)12-5-3-4-11(12)8-16/h6-7,11-12H,3-5,8,16H2,1-2H3,(H,17,18) |
| InChIKey | GVNIJVFXSYKUSU-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [2-(4,6-dimethyl-1H-benzimidazol-2-yl)cyclopentyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4,6-dimethyl-1H-benzimidazol-2-yl)cyclopentyl]methanamine?
The IUPAC name of [2-(4,6-dimethyl-1H-benzimidazol-2-yl)cyclopentyl]methanamine (CID 82946852) is [2-(4,6-dimethyl-1H-benzimidazol-2-yl)cyclopentyl]methanamine.
What is the SMILES notation for [2-(4,6-dimethyl-1H-benzimidazol-2-yl)cyclopentyl]methanamine?
The canonical SMILES for [2-(4,6-dimethyl-1H-benzimidazol-2-yl)cyclopentyl]methanamine is Cc1cc(C)c2nc(C3CCCC3CN)[nH]c2c1.
What is the InChIKey of [2-(4,6-dimethyl-1H-benzimidazol-2-yl)cyclopentyl]methanamine?
The InChIKey is GVNIJVFXSYKUSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N3/c1-9-6-10(2)14-13(7-9)17-15(18-14)12-5-3-4-11(12)8-16/h6-7,11-12H,3-5,8,16H2,1-2H3,(H,17,18).
What are the key properties of [2-(4,6-dimethyl-1H-benzimidazol-2-yl)cyclopentyl]methanamine?
[2-(4,6-dimethyl-1H-benzimidazol-2-yl)cyclopentyl]methanamine has a molecular weight of 243.35 g/mol, XLogP of 3.02, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4,6-dimethyl-1H-benzimidazol-2-yl)cyclopentyl]methanamine is sourced from PubChem (CID 82946852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).