C17H24N2 — CID 82947050
2-(2-cyclohexylethyl)-4,6-dimethyl-1H-benzimidazole (PubChem CID 82947050) has the molecular formula C17H24N2 and a molecular weight of 256.39 g/mol. Its IUPAC name is 2-(2-cyclohexylethyl)-4,6-dimethyl-1H-benzimidazole.
| Compound Name | 2-(2-cyclohexylethyl)-4,6-dimethyl-1H-benzimidazole |
|---|---|
| PubChem CID | 82947050 |
| Molecular Formula | C17H24N2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | 2-(2-cyclohexylethyl)-4,6-dimethyl-1H-benzimidazole |
| SMILES | Cc1cc(C)c2nc(CCC3CCCCC3)[nH]c2c1 |
| InChI | InChI=1S/C17H24N2/c1-12-10-13(2)17-15(11-12)18-16(19-17)9-8-14-6-4-3-5-7-14/h10-11,14H,3-9H2,1-2H3,(H,18,19) |
| InChIKey | XGKVXRGSOFHIFV-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |