About 2-amino-4,5-dimethyl-1-(3-propoxypropyl)pyrrole-3-carbonitrile
2-amino-4,5-dimethyl-1-(3-propoxypropyl)pyrrole-3-carbonitrile (PubChem CID 82947324) has the molecular formula C13H21N3O
and a molecular weight of 235.33 g/mol. Its IUPAC name is 2-amino-4,5-dimethyl-1-(3-propoxypropyl)pyrrole-3-carbonitrile.
Molecular Properties
| Compound Name | 2-amino-4,5-dimethyl-1-(3-propoxypropyl)pyrrole-3-carbonitrile |
| PubChem CID | 82947324 |
| Molecular Formula | C13H21N3O |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | 2-amino-4,5-dimethyl-1-(3-propoxypropyl)pyrrole-3-carbonitrile |
| SMILES | CCCOCCCn1c(C)c(C)c(C#N)c1N |
| InChI | InChI=1S/C13H21N3O/c1-4-7-17-8-5-6-16-11(3)10(2)12(9-14)13(16)15/h4-8,15H2,1-3H3 |
| InChIKey | JGDKWFHTVBCHPQ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 63.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-4,5-dimethyl-1-(3-propoxypropyl)pyrrole-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4,5-dimethyl-1-(3-propoxypropyl)pyrrole-3-carbonitrile?
The IUPAC name of 2-amino-4,5-dimethyl-1-(3-propoxypropyl)pyrrole-3-carbonitrile (CID 82947324) is 2-amino-4,5-dimethyl-1-(3-propoxypropyl)pyrrole-3-carbonitrile.
What is the SMILES notation for 2-amino-4,5-dimethyl-1-(3-propoxypropyl)pyrrole-3-carbonitrile?
The canonical SMILES for 2-amino-4,5-dimethyl-1-(3-propoxypropyl)pyrrole-3-carbonitrile is CCCOCCCn1c(C)c(C)c(C#N)c1N.
What is the InChIKey of 2-amino-4,5-dimethyl-1-(3-propoxypropyl)pyrrole-3-carbonitrile?
The InChIKey is JGDKWFHTVBCHPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N3O/c1-4-7-17-8-5-6-16-11(3)10(2)12(9-14)13(16)15/h4-8,15H2,1-3H3.
What are the key properties of 2-amino-4,5-dimethyl-1-(3-propoxypropyl)pyrrole-3-carbonitrile?
2-amino-4,5-dimethyl-1-(3-propoxypropyl)pyrrole-3-carbonitrile has a molecular weight of 235.33 g/mol, XLogP of 2.38, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4,5-dimethyl-1-(3-propoxypropyl)pyrrole-3-carbonitrile is sourced from PubChem (CID 82947324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).