C8H16N4OS — CID 82947352
5-N-(3-propoxypropyl)-1,2,4-thiadiazole-3,5-diamine (PubChem CID 82947352) has the molecular formula C8H16N4OS and a molecular weight of 216.31 g/mol. Its IUPAC name is 5-N-(3-propoxypropyl)-1,2,4-thiadiazole-3,5-diamine.
| Compound Name | 5-N-(3-propoxypropyl)-1,2,4-thiadiazole-3,5-diamine |
|---|---|
| PubChem CID | 82947352 |
| Molecular Formula | C8H16N4OS |
| Molecular Weight | 216.31 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 5-N-(3-propoxypropyl)-1,2,4-thiadiazole-3,5-diamine |
| SMILES | CCCOCCCNc1nc(N)ns1 |
| InChI | InChI=1S/C8H16N4OS/c1-2-5-13-6-3-4-10-8-11-7(9)12-14-8/h2-6H2,1H3,(H3,9,10,11,12) |
| InChIKey | FNCBZXYXLGMREU-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.31 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|