C12H21N3O — CID 82947515
1-(3-propoxypropyl)-4,5,6,7-tetrahydroimidazo[4,5-c]pyridine (PubChem CID 82947515) has the molecular formula C12H21N3O and a molecular weight of 223.32 g/mol. Its IUPAC name is 1-(3-propoxypropyl)-4,5,6,7-tetrahydroimidazo[4,5-c]pyridine.
| Compound Name | 1-(3-propoxypropyl)-4,5,6,7-tetrahydroimidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 82947515 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | 1-(3-propoxypropyl)-4,5,6,7-tetrahydroimidazo[4,5-c]pyridine |
| SMILES | CCCOCCCn1cnc2c1CCNC2 |
| InChI | InChI=1S/C12H21N3O/c1-2-7-16-8-3-6-15-10-14-11-9-13-5-4-12(11)15/h10,13H,2-9H2,1H3 |
| InChIKey | RTJKBLSPSYRDSD-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|