C15H22N4 — CID 82949000
4,6-dimethyl-2-(1,3,5-trimethylpyrazol-4-yl)-4,5,6,7-tetrahydro-1H-benzimidazole (PubChem CID 82949000) has the molecular formula C15H22N4 and a molecular weight of 258.37 g/mol. Its IUPAC name is 4,6-dimethyl-2-(1,3,5-trimethylpyrazol-4-yl)-4,5,6,7-tetrahydro-1H-benzimidazole.
| Compound Name | 4,6-dimethyl-2-(1,3,5-trimethylpyrazol-4-yl)-4,5,6,7-tetrahydro-1H-benzimidazole |
|---|---|
| PubChem CID | 82949000 |
| Molecular Formula | C15H22N4 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | 4,6-dimethyl-2-(1,3,5-trimethylpyrazol-4-yl)-4,5,6,7-tetrahydro-1H-benzimidazole |
| SMILES | Cc1nn(C)c(C)c1-c1nc2c([nH]1)CC(C)CC2C |
| InChI | InChI=1S/C15H22N4/c1-8-6-9(2)14-12(7-8)16-15(17-14)13-10(3)18-19(5)11(13)4/h8-9H,6-7H2,1-5H3,(H,16,17) |
| InChIKey | UDWKTCCHXMXHOA-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |