C15H24ClN3O — CID 82949522
5-chloro-N-[1-(dimethylamino)propan-2-yl]-2-(propylamino)benzamide (PubChem CID 82949522) has the molecular formula C15H24ClN3O and a molecular weight of 297.83 g/mol. Its IUPAC name is 5-chloro-N-[1-(dimethylamino)propan-2-yl]-2-(propylamino)benzamide.
| Compound Name | 5-chloro-N-[1-(dimethylamino)propan-2-yl]-2-(propylamino)benzamide |
|---|---|
| PubChem CID | 82949522 |
| Molecular Formula | C15H24ClN3O |
| Molecular Weight | 297.83 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | 5-chloro-N-[1-(dimethylamino)propan-2-yl]-2-(propylamino)benzamide |
| SMILES | CCCNc1ccc(Cl)cc1C(=O)NC(C)CN(C)C |
| InChI | InChI=1S/C15H24ClN3O/c1-5-8-17-14-7-6-12(16)9-13(14)15(20)18-11(2)10-19(3)4/h6-7,9,11,17H,5,8,10H2,1-4H3,(H,18,20) |
| InChIKey | WROMJDQZHUCHSL-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.83 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |