C10H20N6 — CID 82949727
2-N-(6-hydrazinyl-5-methylpyrimidin-4-yl)-1-N,1-N-dimethylpropane-1,2-diamine (PubChem CID 82949727) has the molecular formula C10H20N6 and a molecular weight of 224.31 g/mol. Its IUPAC name is 2-N-(6-hydrazinyl-5-methylpyrimidin-4-yl)-1-N,1-N-dimethylpropane-1,2-diamine.
| Compound Name | 2-N-(6-hydrazinyl-5-methylpyrimidin-4-yl)-1-N,1-N-dimethylpropane-1,2-diamine |
|---|---|
| PubChem CID | 82949727 |
| Molecular Formula | C10H20N6 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.17 |
| IUPAC Name | 2-N-(6-hydrazinyl-5-methylpyrimidin-4-yl)-1-N,1-N-dimethylpropane-1,2-diamine |
| SMILES | Cc1c(NN)ncnc1NC(C)CN(C)C |
| InChI | InChI=1S/C10H20N6/c1-7(5-16(3)4)14-9-8(2)10(15-11)13-6-12-9/h6-7H,5,11H2,1-4H3,(H2,12,13,14,15) |
| InChIKey | JNWRXNVRWRIGRZ-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|